About 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid
6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid (PubChem CID 86340819) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid.
Analyze 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The IUPAC name of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid (CID 86340819) is 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid.
What is the SMILES notation for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The canonical SMILES for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid is CC1NC(N)=CC=C1C(=O)O.
What is the InChIKey of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The InChIKey is ZHYOJBHFFOXEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-4,9H,8H2,1H3,(H,10,11).
What are the key properties of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid has a molecular weight of 154.17 g/mol, XLogP of -0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid is sourced from PubChem (CID 86340819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).