6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid

C7H10N2O2 — CID 86340819

IUPAC6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid
SMILESCC1NC(N)=CC=C1C(=O)O
InChIInChI=1S/C7H10N2O2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-4,9H,8H2,1H3,(H,10,11)
InChIKeyZHYOJBHFFOXEIC-UHFFFAOYSA-N
MW154.17 g/mol
LogP-0.21
Rot. Bonds1

About 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid

6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid (PubChem CID 86340819) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid
PubChem CID86340819
Molecular FormulaC7H10N2O2
Molecular Weight154.17 g/mol
Exact Mass154.07
IUPAC Name6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid
SMILESCC1NC(N)=CC=C1C(=O)O
InChIInChI=1S/C7H10N2O2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-4,9H,8H2,1H3,(H,10,11)
InChIKeyZHYOJBHFFOXEIC-UHFFFAOYSA-N
XLogP-0.21
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.17
LogP ≤ 5-0.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The IUPAC name of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid (CID 86340819) is 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid.
What is the SMILES notation for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The canonical SMILES for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid is CC1NC(N)=CC=C1C(=O)O.
What is the InChIKey of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
The InChIKey is ZHYOJBHFFOXEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-4,9H,8H2,1H3,(H,10,11).
What are the key properties of 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid?
6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid has a molecular weight of 154.17 g/mol, XLogP of -0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-methyl-1,2-dihydropyridine-3-carboxylic acid is sourced from PubChem (CID 86340819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).