C9H13NO5S — CID 157384160
5-amino-5,6-dimethyl-4-sulfocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 157384160) has the molecular formula C9H13NO5S and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-amino-5,6-dimethyl-4-sulfocyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-amino-5,6-dimethyl-4-sulfocyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 157384160 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 5-amino-5,6-dimethyl-4-sulfocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=C(S(=O)(=O)O)C1(C)N |
| InChI | InChI=1S/C9H13NO5S/c1-5-6(8(11)12)3-4-7(9(5,2)10)16(13,14)15/h3-5H,10H2,1-2H3,(H,11,12)(H,13,14,15) |
| InChIKey | DIUBGJWRQGZPBH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|