C11H12O7S — CID 87785453
8-methyl-3-sulfobicyclo[4.2.0]octa-2,4-diene-1,5-dicarboxylic acid (PubChem CID 87785453) has the molecular formula C11H12O7S and a molecular weight of 288.28 g/mol. Its IUPAC name is 8-methyl-3-sulfobicyclo[4.2.0]octa-2,4-diene-1,5-dicarboxylic acid.
| Compound Name | 8-methyl-3-sulfobicyclo[4.2.0]octa-2,4-diene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 87785453 |
| Molecular Formula | C11H12O7S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 8-methyl-3-sulfobicyclo[4.2.0]octa-2,4-diene-1,5-dicarboxylic acid |
| SMILES | CC1CC2C(C(=O)O)=CC(S(=O)(=O)O)=CC12C(=O)O |
| InChI | InChI=1S/C11H12O7S/c1-5-2-8-7(9(12)13)3-6(19(16,17)18)4-11(5,8)10(14)15/h3-5,8H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17,18) |
| InChIKey | XQSIMZUNVJUKBH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|