C15H11ClO5 — CID 67913725
2-(6-carboxy-6-chlorocyclohexa-2,4-diene-1-carbonyl)benzoic acid (PubChem CID 67913725) has the molecular formula C15H11ClO5 and a molecular weight of 306.70 g/mol. Its IUPAC name is 2-(6-carboxy-6-chlorocyclohexa-2,4-diene-1-carbonyl)benzoic acid.
| Compound Name | 2-(6-carboxy-6-chlorocyclohexa-2,4-diene-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 67913725 |
| Molecular Formula | C15H11ClO5 |
| Molecular Weight | 306.70 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(6-carboxy-6-chlorocyclohexa-2,4-diene-1-carbonyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)C1C=CC=CC1(Cl)C(=O)O |
| InChI | InChI=1S/C15H11ClO5/c16-15(14(20)21)8-4-3-7-11(15)12(17)9-5-1-2-6-10(9)13(18)19/h1-8,11H,(H,18,19)(H,20,21) |
| InChIKey | YYBZMZCEXMGIRB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|