About dichloropalladium;phthalic acid
dichloropalladium;phthalic acid (PubChem CID 174947627) has the molecular formula C8H6Cl2O4Pd
and a molecular weight of 343.46 g/mol. Its IUPAC name is dichloropalladium;phthalic acid.
Molecular Properties
| Compound Name | dichloropalladium;phthalic acid |
| PubChem CID | 174947627 |
| Molecular Formula | C8H6Cl2O4Pd |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | dichloropalladium;phthalic acid |
| SMILES | Cl[Pd]Cl.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.2ClH.Pd/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;/h1-4H,(H,9,10)(H,11,12);2*1H;/q;;;+2/p-2 |
| InChIKey | VVMIAUKWILCOEV-UHFFFAOYSA-L |
| XLogP | 2.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichloropalladium;phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;phthalic acid?
The IUPAC name of dichloropalladium;phthalic acid (CID 174947627) is dichloropalladium;phthalic acid.
What is the SMILES notation for dichloropalladium;phthalic acid?
The canonical SMILES for dichloropalladium;phthalic acid is Cl[Pd]Cl.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of dichloropalladium;phthalic acid?
The InChIKey is VVMIAUKWILCOEV-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.2ClH.Pd/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;/h1-4H,(H,9,10)(H,11,12);2*1H;/q;;;+2/p-2.
What are the key properties of dichloropalladium;phthalic acid?
dichloropalladium;phthalic acid has a molecular weight of 343.46 g/mol, XLogP of 2.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;phthalic acid is sourced from PubChem (CID 174947627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).