C34H27BrO10 — CID 66757960
2-hydroxy-1-phenyl-2-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyl-6-bromo-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone (PubChem CID 66757960) has the molecular formula C34H27BrO10 and a molecular weight of 675.48 g/mol. Its IUPAC name is 2-hydroxy-1-phenyl-2-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyl-6-bromo-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone.
| Compound Name | 2-hydroxy-1-phenyl-2-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyl-6-bromo-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 66757960 |
| Molecular Formula | C34H27BrO10 |
| Molecular Weight | 675.48 g/mol |
| Exact Mass | 674.08 |
| IUPAC Name | 2-hydroxy-1-phenyl-2-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyl-6-bromo-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone |
| SMILES | O=C(c1ccccc1)C(O)[C@H]1O[C@@](O)(Br)[C@](O)(C(=O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H27BrO10/c35-34(44)33(43,29(40)24-19-11-4-12-20-24)32(42,28(39)23-17-9-3-10-18-23)31(41,27(38)22-15-7-2-8-16-22)30(45-34)26(37)25(36)21-13-5-1-6-14-21/h1-20,26,30,37,41-44H/t26?,30-,31-,32+,33+,34-/m1/s1 |
| InChIKey | UUDMMXFZPBKRKM-BAPGAINCSA-N |
| XLogP | 2.51 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|