C17H20O7 — CID 70004536
2-[(2S,3R,4S,5R)-4,5-diacetyl-4,5-dihydroxy-3-methyloxolan-2-yl]-2-hydroxy-1-phenylethanone (PubChem CID 70004536) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-4,5-diacetyl-4,5-dihydroxy-3-methyloxolan-2-yl]-2-hydroxy-1-phenylethanone.
| Compound Name | 2-[(2S,3R,4S,5R)-4,5-diacetyl-4,5-dihydroxy-3-methyloxolan-2-yl]-2-hydroxy-1-phenylethanone |
|---|---|
| PubChem CID | 70004536 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-4,5-diacetyl-4,5-dihydroxy-3-methyloxolan-2-yl]-2-hydroxy-1-phenylethanone |
| SMILES | CC(=O)[C@]1(O)O[C@H](C(O)C(=O)c2ccccc2)[C@@H](C)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C17H20O7/c1-9-15(14(21)13(20)12-7-5-4-6-8-12)24-17(23,11(3)19)16(9,22)10(2)18/h4-9,14-15,21-23H,1-3H3/t9-,14?,15+,16+,17+/m1/s1 |
| InChIKey | DVISJILVEZQTSY-VKBWEWOOSA-N |
| XLogP | -0.14 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |