C20H20N2O2 — CID 86121634
2,3-di(ethanimidoyl)-1,4-diphenylbutane-1,4-dione (PubChem CID 86121634) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2,3-di(ethanimidoyl)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2,3-di(ethanimidoyl)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 86121634 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2,3-di(ethanimidoyl)-1,4-diphenylbutane-1,4-dione |
| SMILES | [H]/N=C(\C)C(C(=O)c1ccccc1)C(C(=O)c1ccccc1)/C(C)=N/[H] |
| InChI | InChI=1S/C20H20N2O2/c1-13(21)17(19(23)15-9-5-3-6-10-15)18(14(2)22)20(24)16-11-7-4-8-12-16/h3-12,17-18,21-22H,1-2H3/b21-13+,22-14+ |
| InChIKey | WPNBIXOQXGRXSL-JFMUQQRKSA-N |
| XLogP | 4.06 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|