About CID 24998459
CID 24998459 (PubChem CID 24998459) has the molecular formula C36H27O4
and a molecular weight of 523.61 g/mol.
Molecular Properties
| Compound Name | CID 24998459 |
| PubChem CID | 24998459 |
| Molecular Formula | C36H27O4 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)C([C]1[CH][CH][CH][CH]1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27O4/c37-33(26-17-5-1-6-18-26)31(34(38)27-19-7-2-8-20-27)30(25-15-13-14-16-25)32(35(39)28-21-9-3-10-22-28)36(40)29-23-11-4-12-24-29/h1-24,30-32H |
| InChIKey | SBZFKUDPYNUBCQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 24998459 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24998459?
The IUPAC name of CID 24998459 (CID 24998459) is not available.
What is the SMILES notation for CID 24998459?
The canonical SMILES for CID 24998459 is O=C(c1ccccc1)C(C(=O)c1ccccc1)C([C]1[CH][CH][CH][CH]1)C(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of CID 24998459?
The InChIKey is SBZFKUDPYNUBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27O4/c37-33(26-17-5-1-6-18-26)31(34(38)27-19-7-2-8-20-27)30(25-15-13-14-16-25)32(35(39)28-21-9-3-10-22-28)36(40)29-23-11-4-12-24-29/h1-24,30-32H.
What are the key properties of CID 24998459?
CID 24998459 has a molecular weight of 523.61 g/mol, XLogP of 6.77, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24998459 is sourced from PubChem (CID 24998459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).