C29H26O10 — CID 54360522
(2S)-2-[(2S,3R,4R)-5-acetyl-3,4-dibenzoyl-3,4,5-trihydroxyoxolan-2-yl]-2,3-dihydroxy-1-phenylpropan-1-one (PubChem CID 54360522) has the molecular formula C29H26O10 and a molecular weight of 534.52 g/mol. Its IUPAC name is (2S)-2-[(2S,3R,4R)-5-acetyl-3,4-dibenzoyl-3,4,5-trihydroxyoxolan-2-yl]-2,3-dihydroxy-1-phenylpropan-1-one.
| Compound Name | (2S)-2-[(2S,3R,4R)-5-acetyl-3,4-dibenzoyl-3,4,5-trihydroxyoxolan-2-yl]-2,3-dihydroxy-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 54360522 |
| Molecular Formula | C29H26O10 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (2S)-2-[(2S,3R,4R)-5-acetyl-3,4-dibenzoyl-3,4,5-trihydroxyoxolan-2-yl]-2,3-dihydroxy-1-phenylpropan-1-one |
| SMILES | CC(=O)C1(O)O[C@@H]([C@@](O)(CO)C(=O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26O10/c1-18(31)29(38)28(37,24(34)21-15-9-4-10-16-21)27(36,23(33)20-13-7-3-8-14-20)25(39-29)26(35,17-30)22(32)19-11-5-2-6-12-19/h2-16,25,30,35-38H,17H2,1H3/t25-,26+,27+,28-,29?/m0/s1 |
| InChIKey | UMDXHKRSHRVTAL-VOTWOKPGSA-N |
| XLogP | 0.50 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |