C43H36O13 — CID 90912085
(2R)-2-[(2S,3R,4S)-3-benzoyl-3,4,5-trihydroxy-4,5-bis(2-phenoxyacetyl)oxolan-2-yl]-2,4-dihydroxy-1,4-diphenylbutane-1,3-dione (PubChem CID 90912085) has the molecular formula C43H36O13 and a molecular weight of 760.75 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,4S)-3-benzoyl-3,4,5-trihydroxy-4,5-bis(2-phenoxyacetyl)oxolan-2-yl]-2,4-dihydroxy-1,4-diphenylbutane-1,3-dione.
| Compound Name | (2R)-2-[(2S,3R,4S)-3-benzoyl-3,4,5-trihydroxy-4,5-bis(2-phenoxyacetyl)oxolan-2-yl]-2,4-dihydroxy-1,4-diphenylbutane-1,3-dione |
|---|---|
| PubChem CID | 90912085 |
| Molecular Formula | C43H36O13 |
| Molecular Weight | 760.75 g/mol |
| Exact Mass | 760.22 |
| IUPAC Name | (2R)-2-[(2S,3R,4S)-3-benzoyl-3,4,5-trihydroxy-4,5-bis(2-phenoxyacetyl)oxolan-2-yl]-2,4-dihydroxy-1,4-diphenylbutane-1,3-dione |
| SMILES | O=C(COc1ccccc1)C1(O)O[C@H]([C@@](O)(C(=O)c2ccccc2)C(=O)C(O)c2ccccc2)[C@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C43H36O13/c44-33(26-54-31-22-12-4-13-23-31)42(52)41(51,37(48)30-20-10-3-11-21-30)39(56-43(42,53)34(45)27-55-32-24-14-5-15-25-32)40(50,36(47)29-18-8-2-9-19-29)38(49)35(46)28-16-6-1-7-17-28/h1-25,35,39,46,50-53H,26-27H2/t35?,39-,40-,41-,42-,43?/m1/s1 |
| InChIKey | ZMECYZAKVOFISK-WSAHQVGSSA-N |
| XLogP | 2.63 |
| TPSA | 214.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|