C16H12O5 — CID 141151847
2-(dioxiran-3-yl)-2-hydroxy-1,3-diphenylpropane-1,3-dione (PubChem CID 141151847) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(dioxiran-3-yl)-2-hydroxy-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-(dioxiran-3-yl)-2-hydroxy-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 141151847 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(dioxiran-3-yl)-2-hydroxy-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(O)(C(=O)c1ccccc1)C1OO1 |
| InChI | InChI=1S/C16H12O5/c17-13(11-7-3-1-4-8-11)16(19,15-20-21-15)14(18)12-9-5-2-6-10-12/h1-10,15,19H |
| InChIKey | QABRWHUFYMJTTG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|