C18H16O3 — CID 11708930
2-cyclopropyl-2-hydroxy-1,3-diphenylpropane-1,3-dione (PubChem CID 11708930) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-cyclopropyl-2-hydroxy-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-cyclopropyl-2-hydroxy-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 11708930 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-cyclopropyl-2-hydroxy-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(O)(C(=O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H16O3/c19-16(13-7-3-1-4-8-13)18(21,15-11-12-15)17(20)14-9-5-2-6-10-14/h1-10,15,21H,11-12H2 |
| InChIKey | BIZUADAXGBXWJM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|