C17H16O2 — CID 69294173
2-cyclopropyl-2-hydroxy-1,2-diphenylethanone (PubChem CID 69294173) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-cyclopropyl-2-hydroxy-1,2-diphenylethanone.
| Compound Name | 2-cyclopropyl-2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 69294173 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-cyclopropyl-2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C17H16O2/c18-16(13-7-3-1-4-8-13)17(19,15-11-12-15)14-9-5-2-6-10-14/h1-10,15,19H,11-12H2 |
| InChIKey | TYLOCQSOCSBIQK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |