C23H16O5 — CID 134836155
4-(1-hydroxy-2-oxo-1,2-diphenylethyl)-4H-isochromene-1,3-dione (PubChem CID 134836155) has the molecular formula C23H16O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-(1-hydroxy-2-oxo-1,2-diphenylethyl)-4H-isochromene-1,3-dione.
| Compound Name | 4-(1-hydroxy-2-oxo-1,2-diphenylethyl)-4H-isochromene-1,3-dione |
|---|---|
| PubChem CID | 134836155 |
| Molecular Formula | C23H16O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-(1-hydroxy-2-oxo-1,2-diphenylethyl)-4H-isochromene-1,3-dione |
| SMILES | O=C1OC(=O)C(C(O)(C(=O)c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H16O5/c24-20(15-9-3-1-4-10-15)23(27,16-11-5-2-6-12-16)19-17-13-7-8-14-18(17)21(25)28-22(19)26/h1-14,19,27H |
| InChIKey | YQBCUAJBQYGZPM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|