C16H22O3 — CID 139798779
2-cyclohexyl-2,2-dimethoxy-1-phenylethanone (PubChem CID 139798779) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-cyclohexyl-2,2-dimethoxy-1-phenylethanone.
| Compound Name | 2-cyclohexyl-2,2-dimethoxy-1-phenylethanone |
|---|---|
| PubChem CID | 139798779 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-cyclohexyl-2,2-dimethoxy-1-phenylethanone |
| SMILES | COC(OC)(C(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H22O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3,5-6,9-10,14H,4,7-8,11-12H2,1-2H3 |
| InChIKey | UMVAAVNNDNJQMG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|