C22H22O9 — CID 57014626
1-[(1R,2S,3R,4R,5S,6R)-2,5-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone (PubChem CID 57014626) has the molecular formula C22H22O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4R,5S,6R)-2,5-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone.
| Compound Name | 1-[(1R,2S,3R,4R,5S,6R)-2,5-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 57014626 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[(1R,2S,3R,4R,5S,6R)-2,5-dibenzoyl-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@H](O)[C@](O)(C(=O)c2ccccc2)[C@H](O)[C@@H](O)[C@@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O9/c1-12(23)21(30)19(28)20(29,15(24)13-8-4-2-5-9-13)17(26)18(27)22(21,31)16(25)14-10-6-3-7-11-14/h2-11,17-19,26-31H,1H3/t17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | PJWOEAYYLAKKMZ-JOLMYRCBSA-N |
| XLogP | -1.37 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |