C18H26O6 — CID 11515589
(2S,3R)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-hydroxy-2-methyl-1-phenylpropan-1-one (PubChem CID 11515589) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2S,3R)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-hydroxy-2-methyl-1-phenylpropan-1-one.
| Compound Name | (2S,3R)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-hydroxy-2-methyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 11515589 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2S,3R)-3-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-hydroxy-2-methyl-1-phenylpropan-1-one |
| SMILES | CO[C@]1(C)OC[C@@H]([C@H](O)[C@H](C)C(=O)c2ccccc2)O[C@@]1(C)OC |
| InChI | InChI=1S/C18H26O6/c1-12(15(19)13-9-7-6-8-10-13)16(20)14-11-23-17(2,21-4)18(3,22-5)24-14/h6-10,12,14,16,20H,11H2,1-5H3/t12-,14+,16-,17-,18-/m1/s1 |
| InChIKey | UUKLWYKLFHODMZ-PYHPYESLSA-N |
| XLogP | 2.01 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |