C13H27O8P — CID 102046630
(R)-diethoxyphosphoryl-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol (PubChem CID 102046630) has the molecular formula C13H27O8P and a molecular weight of 342.33 g/mol. Its IUPAC name is (R)-diethoxyphosphoryl-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol.
| Compound Name | (R)-diethoxyphosphoryl-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 102046630 |
| Molecular Formula | C13H27O8P |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (R)-diethoxyphosphoryl-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
| SMILES | CCOP(=O)(OCC)[C@@H](O)[C@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C13H27O8P/c1-7-19-22(15,20-8-2)11(14)10-9-18-12(3,16-5)13(4,17-6)21-10/h10-11,14H,7-9H2,1-6H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | MHXHSVVMROQXIO-FDYHWXHSSA-N |
| XLogP | 1.71 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|