C9H17BrO4 — CID 101122186
(2S,3S,5S)-5-(bromomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane (PubChem CID 101122186) has the molecular formula C9H17BrO4 and a molecular weight of 269.13 g/mol. Its IUPAC name is (2S,3S,5S)-5-(bromomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane.
| Compound Name | (2S,3S,5S)-5-(bromomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 101122186 |
| Molecular Formula | C9H17BrO4 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (2S,3S,5S)-5-(bromomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
| SMILES | CO[C@@]1(C)OC[C@@H](CBr)O[C@]1(C)OC |
| InChI | InChI=1S/C9H17BrO4/c1-8(11-3)9(2,12-4)14-7(5-10)6-13-8/h7H,5-6H2,1-4H3/t7-,8+,9+/m1/s1 |
| InChIKey | LCFXXSNCGHBIBL-VGMNWLOBSA-N |
| XLogP | 1.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|