C14H27NO6S — CID 139080103
(2S)-1-tert-butylsulfonyl-2-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]aziridine (PubChem CID 139080103) has the molecular formula C14H27NO6S and a molecular weight of 337.44 g/mol. Its IUPAC name is (2S)-1-tert-butylsulfonyl-2-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]aziridine.
| Compound Name | (2S)-1-tert-butylsulfonyl-2-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]aziridine |
|---|---|
| PubChem CID | 139080103 |
| Molecular Formula | C14H27NO6S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (2S)-1-tert-butylsulfonyl-2-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]aziridine |
| SMILES | CO[C@]1(C)OC[C@H]([C@@H]2CN2S(=O)(=O)C(C)(C)C)O[C@@]1(C)OC |
| InChI | InChI=1S/C14H27NO6S/c1-12(2,3)22(16,17)15-8-10(15)11-9-20-13(4,18-6)14(5,19-7)21-11/h10-11H,8-9H2,1-7H3/t10-,11+,13+,14+,15?/m0/s1 |
| InChIKey | WSXSGKLLHJERDQ-QBSYWKJKSA-N |
| XLogP | 0.94 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|