C12H22O7 — CID 10707711
(2S,3S,4aR,7S,8S,8aR)-2,3,7-trimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol (PubChem CID 10707711) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2S,3S,4aR,7S,8S,8aR)-2,3,7-trimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol.
| Compound Name | (2S,3S,4aR,7S,8S,8aR)-2,3,7-trimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
|---|---|
| PubChem CID | 10707711 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2S,3S,4aR,7S,8S,8aR)-2,3,7-trimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
| SMILES | CO[C@H]1OC[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C12H22O7/c1-11(15-4)12(2,16-5)19-9-7(18-11)6-17-10(14-3)8(9)13/h7-10,13H,6H2,1-5H3/t7-,8+,9+,10+,11+,12+/m1/s1 |
| InChIKey | VZHFRTIUAIJCNB-VXXUGFECSA-N |
| XLogP | -0.14 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |