C15H26O7S — CID 11792150
methyl (2R,3S,5R,6R)-3-tert-butylsulfanylcarbonyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 11792150) has the molecular formula C15H26O7S and a molecular weight of 350.43 g/mol. Its IUPAC name is methyl (2R,3S,5R,6R)-3-tert-butylsulfanylcarbonyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2R,3S,5R,6R)-3-tert-butylsulfanylcarbonyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 11792150 |
| Molecular Formula | C15H26O7S |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | methyl (2R,3S,5R,6R)-3-tert-butylsulfanylcarbonyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1C(=O)SC(C)(C)C |
| InChI | InChI=1S/C15H26O7S/c1-13(2,3)23-12(17)10-9(11(16)18-6)21-14(4,19-7)15(5,20-8)22-10/h9-10H,1-8H3/t9-,10+,14-,15-/m1/s1 |
| InChIKey | RSTJINQSJKEZRX-ANGCBRKESA-N |
| XLogP | 1.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|