C17H31NO7 — CID 11462575
methyl (2R,3R,5R,6R)-3-(dipropylcarbamoyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 11462575) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl (2R,3R,5R,6R)-3-(dipropylcarbamoyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2R,3R,5R,6R)-3-(dipropylcarbamoyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 11462575 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | methyl (2R,3R,5R,6R)-3-(dipropylcarbamoyl)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | CCCN(CCC)C(=O)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H31NO7/c1-8-10-18(11-9-2)14(19)12-13(15(20)21-5)25-17(4,23-7)16(3,22-6)24-12/h12-13H,8-11H2,1-7H3/t12-,13-,16-,17-/m1/s1 |
| InChIKey | ZEBXIHHUOPORKY-BQGCOEIASA-N |
| XLogP | 1.32 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |