C21H36N2O2 — CID 98532727
(1R,2S,3R,4R)-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 98532727) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (1R,2S,3R,4R)-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2S,3R,4R)-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 98532727 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (1R,2S,3R,4R)-2-N,2-N,3-N,3-N-tetrapropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)[C@@H]1[C@H](C(=O)N(CCC)CCC)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C21H36N2O2/c1-5-11-22(12-6-2)20(24)18-16-9-10-17(15-16)19(18)21(25)23(13-7-3)14-8-4/h9-10,16-19H,5-8,11-15H2,1-4H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | QOWCQGPBXFLEAL-CADBVGFASA-N |
| XLogP | 3.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|