C15H23NO5 — CID 50904089
(1S,2R,3R,4R)-3-[bis(2-methoxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 50904089) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-[bis(2-methoxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4R)-3-[bis(2-methoxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 50904089 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (1S,2R,3R,4R)-3-[bis(2-methoxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COCCN(CCOC)C(=O)[C@H]1[C@H](C(=O)O)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H23NO5/c1-20-7-5-16(6-8-21-2)14(17)12-10-3-4-11(9-10)13(12)15(18)19/h3-4,10-13H,5-9H2,1-2H3,(H,18,19)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | SBWWMRUDYNGBBT-UMSGYPCISA-N |
| XLogP | 0.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|