C14H19NO4 — CID 114091752
(2R,3S)-3-[cyclopropyl(2-hydroxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 114091752) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2R,3S)-3-[cyclopropyl(2-hydroxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (2R,3S)-3-[cyclopropyl(2-hydroxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 114091752 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2R,3S)-3-[cyclopropyl(2-hydroxyethyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C2C=CC(C2)[C@@H]1C(=O)N(CCO)C1CC1 |
| InChI | InChI=1S/C14H19NO4/c16-6-5-15(10-3-4-10)13(17)11-8-1-2-9(7-8)12(11)14(18)19/h1-2,8-12,16H,3-7H2,(H,18,19)/t8?,9?,11-,12+/m0/s1 |
| InChIKey | LGPFZXYNCNVDOK-CHCPCTANSA-N |
| XLogP | 0.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|