C19H27NO7 — CID 11794218
methyl (4R,5R)-5-[benzyl(2,2-dimethoxyethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 11794218) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl (4R,5R)-5-[benzyl(2,2-dimethoxyethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5R)-5-[benzyl(2,2-dimethoxyethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 11794218 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | methyl (4R,5R)-5-[benzyl(2,2-dimethoxyethyl)carbamoyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C)O[C@H]1C(=O)N(Cc1ccccc1)CC(OC)OC |
| InChI | InChI=1S/C19H27NO7/c1-19(2)26-15(16(27-19)18(22)25-5)17(21)20(12-14(23-3)24-4)11-13-9-7-6-8-10-13/h6-10,14-16H,11-12H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | DJCGWFDPILKXIK-HZPDHXFCSA-N |
| XLogP | 1.33 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|