C9H14O10S2 — CID 134599892
dimethyl 3,3-dimethyl-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6,7-dicarboxylate (PubChem CID 134599892) has the molecular formula C9H14O10S2 and a molecular weight of 346.34 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6,7-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 134599892 |
| Molecular Formula | C9H14O10S2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | dimethyl 3,3-dimethyl-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6,7-dicarboxylate |
| SMILES | COC(=O)C1OS(=O)(=O)C(C)(C)S(=O)(=O)OC1C(=O)OC |
| InChI | InChI=1S/C9H14O10S2/c1-9(2)20(12,13)18-5(7(10)16-3)6(8(11)17-4)19-21(9,14)15/h5-6H,1-4H3 |
| InChIKey | AKZIQJDXMQCFSD-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|