C20H31NO8S — CID 101469122
N-[(1S,2S)-1-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-hydroxy-2-(hydroxymethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 101469122) has the molecular formula C20H31NO8S and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-hydroxy-2-(hydroxymethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-1-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-hydroxy-2-(hydroxymethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101469122 |
| Molecular Formula | C20H31NO8S |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[(1S,2S)-1-[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-1-hydroxy-2-(hydroxymethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=C[C@@](CO)(NS(=O)(=O)c1ccc(C)cc1)[C@H](O)[C@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C20H31NO8S/c1-7-20(13-22,21-30(24,25)15-10-8-14(2)9-11-15)17(23)16-12-28-18(3,26-5)19(4,27-6)29-16/h7-11,16-17,21-23H,1,12-13H2,2-6H3/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | FLGALFYYLNXDIQ-WAPOTWQKSA-N |
| XLogP | 0.69 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|