C21H29NO6S — CID 24744602
ethyl 2-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4-methylphenyl)sulfonyl-prop-2-enylamino]methyl]prop-2-enoate (PubChem CID 24744602) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is ethyl 2-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4-methylphenyl)sulfonyl-prop-2-enylamino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4-methylphenyl)sulfonyl-prop-2-enylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 24744602 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl 2-[(R)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4-methylphenyl)sulfonyl-prop-2-enylamino]methyl]prop-2-enoate |
| SMILES | C=CCN([C@H](C(=C)C(=O)OCC)[C@H]1COC(C)(C)O1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H29NO6S/c1-7-13-22(29(24,25)17-11-9-15(3)10-12-17)19(16(4)20(23)26-8-2)18-14-27-21(5,6)28-18/h7,9-12,18-19H,1,4,8,13-14H2,2-3,5-6H3/t18-,19-/m1/s1 |
| InChIKey | IDOVLZLXZJVNFN-RTBURBONSA-N |
| XLogP | 2.81 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|