C17H29NO7S — CID 15946926
(1R,2R,6R,8R,9R,15S)-10-tert-butylsulfonyl-15-methoxy-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecane (PubChem CID 15946926) has the molecular formula C17H29NO7S and a molecular weight of 391.49 g/mol. Its IUPAC name is (1R,2R,6R,8R,9R,15S)-10-tert-butylsulfonyl-15-methoxy-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecane.
| Compound Name | (1R,2R,6R,8R,9R,15S)-10-tert-butylsulfonyl-15-methoxy-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecane |
|---|---|
| PubChem CID | 15946926 |
| Molecular Formula | C17H29NO7S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (1R,2R,6R,8R,9R,15S)-10-tert-butylsulfonyl-15-methoxy-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecane |
| SMILES | CO[C@@H]1CO[C@]23CCN(S(=O)(=O)C(C)(C)C)[C@H]1[C@H]2O[C@@H]1OC(C)(C)O[C@@H]13 |
| InChI | InChI=1S/C17H29NO7S/c1-15(2,3)26(19,20)18-8-7-17-12(11(18)10(21-6)9-22-17)23-14-13(17)24-16(4,5)25-14/h10-14H,7-9H2,1-6H3/t10-,11-,12-,13+,14-,17-/m1/s1 |
| InChIKey | KRCZUVSKPPHROO-QHMBKZAZSA-N |
| XLogP | 0.85 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |