C11H21NO3S — CID 135086971
(1S,4R)-6-tert-butylsulfonyl-4-methoxy-1-methyl-6-azabicyclo[3.1.0]hexane (PubChem CID 135086971) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is (1S,4R)-6-tert-butylsulfonyl-4-methoxy-1-methyl-6-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,4R)-6-tert-butylsulfonyl-4-methoxy-1-methyl-6-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 135086971 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1S,4R)-6-tert-butylsulfonyl-4-methoxy-1-methyl-6-azabicyclo[3.1.0]hexane |
| SMILES | CO[C@@H]1CC[C@@]2(C)C1N2S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO3S/c1-10(2,3)16(13,14)12-9-8(15-5)6-7-11(9,12)4/h8-9H,6-7H2,1-5H3/t8-,9?,11+,12?/m1/s1 |
| InChIKey | PWUIGAHLHJTTBD-IMXWASOLSA-N |
| XLogP | 1.37 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|