C11H21NO4S — CID 62492505
methyl 1-tert-butylsulfonylpiperidine-4-carboxylate (PubChem CID 62492505) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 1-tert-butylsulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-tert-butylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 62492505 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 1-tert-butylsulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H21NO4S/c1-11(2,3)17(14,15)12-7-5-9(6-8-12)10(13)16-4/h9H,5-8H2,1-4H3 |
| InChIKey | AQFLZISLEUOOET-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |