C12H24N2O5S — CID 79255174
methyl 1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]piperidine-4-carboxylate (PubChem CID 79255174) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 79255174 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl 1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]sulfamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)N[C@H](CO)C(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O5S/c1-9(2)11(8-15)13-20(17,18)14-6-4-10(5-7-14)12(16)19-3/h9-11,13,15H,4-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | GFNCHGTVZJLNNV-LLVKDONJSA-N |
| XLogP | -0.28 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |