C11H23N3O5S — CID 64541717
methyl 1-[(2-amino-3-hydroxybutyl)sulfamoyl]piperidine-4-carboxylate (PubChem CID 64541717) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 1-[(2-amino-3-hydroxybutyl)sulfamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(2-amino-3-hydroxybutyl)sulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 64541717 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 1-[(2-amino-3-hydroxybutyl)sulfamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)NCC(N)C(C)O)CC1 |
| InChI | InChI=1S/C11H23N3O5S/c1-8(15)10(12)7-13-20(17,18)14-5-3-9(4-6-14)11(16)19-2/h8-10,13,15H,3-7,12H2,1-2H3 |
| InChIKey | OJWILIPIIYTYCR-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |