C12H22N2O6S — CID 43362362
3-[(4-ethoxycarbonylpiperidin-1-yl)sulfonylamino]butanoic acid (PubChem CID 43362362) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is 3-[(4-ethoxycarbonylpiperidin-1-yl)sulfonylamino]butanoic acid.
| Compound Name | 3-[(4-ethoxycarbonylpiperidin-1-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43362362 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[(4-ethoxycarbonylpiperidin-1-yl)sulfonylamino]butanoic acid |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)NC(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22N2O6S/c1-3-20-12(17)10-4-6-14(7-5-10)21(18,19)13-9(2)8-11(15)16/h9-10,13H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | IIOPNJFOOBAFAH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |