C10H20N2O5S — CID 43502025
ethyl 1-(2-hydroxyethylsulfamoyl)piperidine-4-carboxylate (PubChem CID 43502025) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl 1-(2-hydroxyethylsulfamoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-hydroxyethylsulfamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43502025 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | ethyl 1-(2-hydroxyethylsulfamoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)NCCO)CC1 |
| InChI | InChI=1S/C10H20N2O5S/c1-2-17-10(14)9-3-6-12(7-4-9)18(15,16)11-5-8-13/h9,11,13H,2-8H2,1H3 |
| InChIKey | CZMGPHNYRDVRNW-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |