C12H24N2O6S — CID 62498446
ethyl 1-[2-(2-hydroxyethoxy)ethylsulfamoyl]piperidine-4-carboxylate (PubChem CID 62498446) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is ethyl 1-[2-(2-hydroxyethoxy)ethylsulfamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-hydroxyethoxy)ethylsulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 62498446 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | ethyl 1-[2-(2-hydroxyethoxy)ethylsulfamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)NCCOCCO)CC1 |
| InChI | InChI=1S/C12H24N2O6S/c1-2-20-12(16)11-3-6-14(7-4-11)21(17,18)13-5-9-19-10-8-15/h11,13,15H,2-10H2,1H3 |
| InChIKey | SLGIUNPZAAFXGT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|