C12H24N2O6S — CID 103887524
methyl 1-[(4-hydroxy-1-methoxybutan-2-yl)sulfamoyl]piperidine-4-carboxylate (PubChem CID 103887524) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl 1-[(4-hydroxy-1-methoxybutan-2-yl)sulfamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(4-hydroxy-1-methoxybutan-2-yl)sulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 103887524 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl 1-[(4-hydroxy-1-methoxybutan-2-yl)sulfamoyl]piperidine-4-carboxylate |
| SMILES | COCC(CCO)NS(=O)(=O)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C12H24N2O6S/c1-19-9-11(5-8-15)13-21(17,18)14-6-3-10(4-7-14)12(16)20-2/h10-11,13,15H,3-9H2,1-2H3 |
| InChIKey | BRRZJMCTLOLUKC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |