C9H21NO4S — CID 106156919
N-(4-hydroxy-1-methoxybutan-2-yl)-2-methylpropane-2-sulfonamide (PubChem CID 106156919) has the molecular formula C9H21NO4S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(4-hydroxy-1-methoxybutan-2-yl)-2-methylpropane-2-sulfonamide.
| Compound Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 106156919 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2-methylpropane-2-sulfonamide |
| SMILES | COCC(CCO)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C9H21NO4S/c1-9(2,3)15(12,13)10-8(5-6-11)7-14-4/h8,10-11H,5-7H2,1-4H3 |
| InChIKey | DHGAJJHMDCVPRM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |