C13H22N2O5S — CID 106152843
2-(2-aminophenoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)ethanesulfonamide (PubChem CID 106152843) has the molecular formula C13H22N2O5S and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-(2-aminophenoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)ethanesulfonamide.
| Compound Name | 2-(2-aminophenoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 106152843 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(2-aminophenoxy)-N-(4-hydroxy-1-methoxybutan-2-yl)ethanesulfonamide |
| SMILES | COCC(CCO)NS(=O)(=O)CCOc1ccccc1N |
| InChI | InChI=1S/C13H22N2O5S/c1-19-10-11(6-7-16)15-21(17,18)9-8-20-13-5-3-2-4-12(13)14/h2-5,11,15-16H,6-10,14H2,1H3 |
| InChIKey | GYHLDXFJPAWFRL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|