C16H23NO6S — CID 134864412
(3'aR,5S,5'R,6'aR)-5'-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-ethenyl-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-2-thione (PubChem CID 134864412) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is (3'aR,5S,5'R,6'aR)-5'-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-ethenyl-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-2-thione.
| Compound Name | (3'aR,5S,5'R,6'aR)-5'-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-ethenyl-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-2-thione |
|---|---|
| PubChem CID | 134864412 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (3'aR,5S,5'R,6'aR)-5'-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-ethenyl-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-2-thione |
| SMILES | C=CN1C[C@]2(OC1=S)[C@@H](C1COC(C)(C)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H23NO6S/c1-6-17-8-16(23-13(17)24)10(9-7-18-14(2,3)20-9)19-12-11(16)21-15(4,5)22-12/h6,9-12H,1,7-8H2,2-5H3/t9?,10-,11+,12-,16+/m1/s1 |
| InChIKey | MBPAZMZBUCPWOG-YGSHCHJHSA-N |
| XLogP | 1.51 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|