C15H22O8 — CID 11809668
methyl 2-hydroxy-2-[(1R,2R,6R,8R)-1,4,4-trimethyl-10-oxo-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-yl]acetate (PubChem CID 11809668) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[(1R,2R,6R,8R)-1,4,4-trimethyl-10-oxo-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-yl]acetate.
| Compound Name | methyl 2-hydroxy-2-[(1R,2R,6R,8R)-1,4,4-trimethyl-10-oxo-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 11809668 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 2-hydroxy-2-[(1R,2R,6R,8R)-1,4,4-trimethyl-10-oxo-3,5,7,13-tetraoxatricyclo[6.5.0.02,6]tridecan-11-yl]acetate |
| SMILES | COC(=O)C(O)C1CO[C@]2(C)[C@@H](CC1=O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H22O8/c1-14(2)22-11-13(23-14)21-9-5-8(16)7(6-20-15(9,11)3)10(17)12(18)19-4/h7,9-11,13,17H,5-6H2,1-4H3/t7?,9-,10?,11+,13-,15-/m1/s1 |
| InChIKey | GXLMNBZKLDPREO-JHIUEJLHSA-N |
| XLogP | -0.24 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |