C20H29NO6S — CID 102104472
1-tert-butylsulfonyl-2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)aziridine (PubChem CID 102104472) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)aziridine.
| Compound Name | 1-tert-butylsulfonyl-2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)aziridine |
|---|---|
| PubChem CID | 102104472 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-tert-butylsulfonyl-2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)aziridine |
| SMILES | CC1(C)OC2OC(C3CN3S(=O)(=O)C(C)(C)C)C(OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C20H29NO6S/c1-19(2,3)28(22,23)21-11-14(21)15-16(24-12-13-9-7-6-8-10-13)17-18(25-15)27-20(4,5)26-17/h6-10,14-18H,11-12H2,1-5H3 |
| InChIKey | MIRUBHBYZZZARP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|