C16H27NO7S — CID 15947012
(1R,2R,6R,8R,9R,15R)-10-tert-butylsulfonyl-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecan-15-ol (PubChem CID 15947012) has the molecular formula C16H27NO7S and a molecular weight of 377.46 g/mol. Its IUPAC name is (1R,2R,6R,8R,9R,15R)-10-tert-butylsulfonyl-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecan-15-ol.
| Compound Name | (1R,2R,6R,8R,9R,15R)-10-tert-butylsulfonyl-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecan-15-ol |
|---|---|
| PubChem CID | 15947012 |
| Molecular Formula | C16H27NO7S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (1R,2R,6R,8R,9R,15R)-10-tert-butylsulfonyl-4,4-dimethyl-3,5,7,13-tetraoxa-10-azatetracyclo[7.3.3.01,8.02,6]pentadecan-15-ol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H]4[C@@H](O)CO[C@@]3(CCN4S(=O)(=O)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C16H27NO7S/c1-14(2,3)25(19,20)17-7-6-16-11(10(17)9(18)8-21-16)22-13-12(16)23-15(4,5)24-13/h9-13,18H,6-8H2,1-5H3/t9-,10+,11+,12-,13+,16+/m0/s1 |
| InChIKey | PZEUAUYMOJWGJM-FKCSRUCOSA-N |
| XLogP | 0.20 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |