C13H20O5 — CID 56935437
2-[(3'aR,5R,5'R,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]propan-2-ol (PubChem CID 56935437) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(3'aR,5R,5'R,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]propan-2-ol.
| Compound Name | 2-[(3'aR,5R,5'R,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]propan-2-ol |
|---|---|
| PubChem CID | 56935437 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[(3'aR,5R,5'R,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]propan-2-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](C(C)(C)O)[C@]3(C=CCO3)[C@H]2O1 |
| InChI | InChI=1S/C13H20O5/c1-11(2,14)10-13(6-5-7-15-13)8-9(16-10)18-12(3,4)17-8/h5-6,8-10,14H,7H2,1-4H3/t8-,9+,10+,13-/m0/s1 |
| InChIKey | YUAXKDZNMUELKS-WTBMIXGQSA-N |
| XLogP | 0.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|