C14H20O4 — CID 101108557
(1S,2R,6R,8S,9R,13R)-4,4,13-trimethyl-3,5,7-trioxatetracyclo[6.6.0.01,11.02,6]tetradec-11-en-9-ol (PubChem CID 101108557) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R,13R)-4,4,13-trimethyl-3,5,7-trioxatetracyclo[6.6.0.01,11.02,6]tetradec-11-en-9-ol.
| Compound Name | (1S,2R,6R,8S,9R,13R)-4,4,13-trimethyl-3,5,7-trioxatetracyclo[6.6.0.01,11.02,6]tetradec-11-en-9-ol |
|---|---|
| PubChem CID | 101108557 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1S,2R,6R,8S,9R,13R)-4,4,13-trimethyl-3,5,7-trioxatetracyclo[6.6.0.01,11.02,6]tetradec-11-en-9-ol |
| SMILES | C[C@H]1C=C2C[C@@H](O)[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@@]23C1 |
| InChI | InChI=1S/C14H20O4/c1-7-4-8-5-9(15)10-14(8,6-7)11-12(16-10)18-13(2,3)17-11/h4,7,9-12,15H,5-6H2,1-3H3/t7-,9+,10+,11-,12+,14-/m0/s1 |
| InChIKey | VOMABYIPRRBLQV-SMNIBXOJSA-N |
| XLogP | 1.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|