C20H29NO6S2 — CID 16667536
(1S,2R,3R,5R,6S,12S)-7-tert-butylsulfonyl-12-methoxy-3-phenylsulfanyl-4,10-dioxa-7-azatricyclo[4.3.3.01,5]dodecan-2-ol (PubChem CID 16667536) has the molecular formula C20H29NO6S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (1S,2R,3R,5R,6S,12S)-7-tert-butylsulfonyl-12-methoxy-3-phenylsulfanyl-4,10-dioxa-7-azatricyclo[4.3.3.01,5]dodecan-2-ol.
| Compound Name | (1S,2R,3R,5R,6S,12S)-7-tert-butylsulfonyl-12-methoxy-3-phenylsulfanyl-4,10-dioxa-7-azatricyclo[4.3.3.01,5]dodecan-2-ol |
|---|---|
| PubChem CID | 16667536 |
| Molecular Formula | C20H29NO6S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (1S,2R,3R,5R,6S,12S)-7-tert-butylsulfonyl-12-methoxy-3-phenylsulfanyl-4,10-dioxa-7-azatricyclo[4.3.3.01,5]dodecan-2-ol |
| SMILES | CO[C@@H]1CO[C@]23CCN(S(=O)(=O)C(C)(C)C)[C@@H]1[C@H]2O[C@H](Sc1ccccc1)[C@@H]3O |
| InChI | InChI=1S/C20H29NO6S2/c1-19(2,3)29(23,24)21-11-10-20-16(22)18(28-13-8-6-5-7-9-13)27-17(20)15(21)14(25-4)12-26-20/h5-9,14-18,22H,10-12H2,1-4H3/t14-,15+,16+,17-,18-,20+/m1/s1 |
| InChIKey | ZYQPIGDBHJRHKA-FGCARQOMSA-N |
| XLogP | 1.85 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |