C20H27N3O4S — CID 102574170
[(2R,3R,3aR,6R,7R,7aS)-7-azido-6-methoxy-2-phenylsulfanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl] 2,2-dimethylpropanoate (PubChem CID 102574170) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is [(2R,3R,3aR,6R,7R,7aS)-7-azido-6-methoxy-2-phenylsulfanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,3aR,6R,7R,7aS)-7-azido-6-methoxy-2-phenylsulfanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102574170 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [(2R,3R,3aR,6R,7R,7aS)-7-azido-6-methoxy-2-phenylsulfanyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1CC[C@H]2[C@@H](OC(=O)C(C)(C)C)[C@@H](Sc3ccccc3)O[C@@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H27N3O4S/c1-20(2,3)19(24)27-17-13-10-11-14(25-4)15(22-23-21)16(13)26-18(17)28-12-8-6-5-7-9-12/h5-9,13-18H,10-11H2,1-4H3/t13-,14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | CRENPOLVFQKZCJ-PDCGBLAGSA-N |
| XLogP | 4.57 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|